About 2,3-dimethylheptane;ethane
2,3-dimethylheptane;ethane (PubChem CID 156648444) has the molecular formula C13H32
and a molecular weight of 188.40 g/mol. Its IUPAC name is 2,3-dimethylheptane;ethane.
Molecular Properties
| Compound Name | 2,3-dimethylheptane;ethane |
| PubChem CID | 156648444 |
| Molecular Formula | C13H32 |
| Molecular Weight | 188.40 g/mol |
| Exact Mass | 188.25 |
| IUPAC Name | 2,3-dimethylheptane;ethane |
| SMILES | CC.CC.CCCCC(C)C(C)C |
| InChI | InChI=1S/C9H20.2C2H6/c1-5-6-7-9(4)8(2)3;2*1-2/h8-9H,5-7H2,1-4H3;2*1-2H3 |
| InChIKey | ZBOVTCPEQCKKKF-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 188.40 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 2,3-dimethylheptane;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-dimethylheptane;ethane?
The IUPAC name of 2,3-dimethylheptane;ethane (CID 156648444) is 2,3-dimethylheptane;ethane.
What is the SMILES notation for 2,3-dimethylheptane;ethane?
The canonical SMILES for 2,3-dimethylheptane;ethane is CC.CC.CCCCC(C)C(C)C.
What is the InChIKey of 2,3-dimethylheptane;ethane?
The InChIKey is ZBOVTCPEQCKKKF-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H20.2C2H6/c1-5-6-7-9(4)8(2)3;2*1-2/h8-9H,5-7H2,1-4H3;2*1-2H3.
What are the key properties of 2,3-dimethylheptane;ethane?
2,3-dimethylheptane;ethane has a molecular weight of 188.40 g/mol, XLogP of 5.52, 4 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-dimethylheptane;ethane is sourced from PubChem (CID 156648444), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).