About (3S)-2,3-dimethylnonane;methane
(3S)-2,3-dimethylnonane;methane (PubChem CID 159246988) has the molecular formula C12H28
and a molecular weight of 172.36 g/mol. Its IUPAC name is (3S)-2,3-dimethylnonane;methane.
Molecular Properties
| Compound Name | (3S)-2,3-dimethylnonane;methane |
| PubChem CID | 159246988 |
| Molecular Formula | C12H28 |
| Molecular Weight | 172.36 g/mol |
| Exact Mass | 172.22 |
| IUPAC Name | (3S)-2,3-dimethylnonane;methane |
| SMILES | C.CCCCCC[C@H](C)C(C)C |
| InChI | InChI=1S/C11H24.CH4/c1-5-6-7-8-9-11(4)10(2)3;/h10-11H,5-9H2,1-4H3;1H4/t11-;/m0./s1 |
| InChIKey | KUUNRAKKXROURS-MERQFXBCSA-N |
| XLogP | 4.89 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 172.36 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze (3S)-2,3-dimethylnonane;methane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S)-2,3-dimethylnonane;methane?
The IUPAC name of (3S)-2,3-dimethylnonane;methane (CID 159246988) is (3S)-2,3-dimethylnonane;methane.
What is the SMILES notation for (3S)-2,3-dimethylnonane;methane?
The canonical SMILES for (3S)-2,3-dimethylnonane;methane is C.CCCCCC[C@H](C)C(C)C.
What is the InChIKey of (3S)-2,3-dimethylnonane;methane?
The InChIKey is KUUNRAKKXROURS-MERQFXBCSA-N. The full InChI is InChI=1S/C11H24.CH4/c1-5-6-7-8-9-11(4)10(2)3;/h10-11H,5-9H2,1-4H3;1H4/t11-;/m0./s1.
What are the key properties of (3S)-2,3-dimethylnonane;methane?
(3S)-2,3-dimethylnonane;methane has a molecular weight of 172.36 g/mol, XLogP of 4.89, 6 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for (3S)-2,3-dimethylnonane;methane is sourced from PubChem (CID 159246988), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).