About (3R)-2,3-dimethylheptane;ethane
(3R)-2,3-dimethylheptane;ethane (PubChem CID 163241846) has the molecular formula C11H26
and a molecular weight of 158.33 g/mol. Its IUPAC name is (3R)-2,3-dimethylheptane;ethane.
Molecular Properties
| Compound Name | (3R)-2,3-dimethylheptane;ethane |
| PubChem CID | 163241846 |
| Molecular Formula | C11H26 |
| Molecular Weight | 158.33 g/mol |
| Exact Mass | 158.20 |
| IUPAC Name | (3R)-2,3-dimethylheptane;ethane |
| SMILES | CC.CCCC[C@@H](C)C(C)C |
| InChI | InChI=1S/C9H20.C2H6/c1-5-6-7-9(4)8(2)3;1-2/h8-9H,5-7H2,1-4H3;1-2H3/t9-;/m1./s1 |
| InChIKey | MCYFOBNYNOSQRB-SBSPUUFOSA-N |
| XLogP | 4.49 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 158.33 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze (3R)-2,3-dimethylheptane;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3R)-2,3-dimethylheptane;ethane?
The IUPAC name of (3R)-2,3-dimethylheptane;ethane (CID 163241846) is (3R)-2,3-dimethylheptane;ethane.
What is the SMILES notation for (3R)-2,3-dimethylheptane;ethane?
The canonical SMILES for (3R)-2,3-dimethylheptane;ethane is CC.CCCC[C@@H](C)C(C)C.
What is the InChIKey of (3R)-2,3-dimethylheptane;ethane?
The InChIKey is MCYFOBNYNOSQRB-SBSPUUFOSA-N. The full InChI is InChI=1S/C9H20.C2H6/c1-5-6-7-9(4)8(2)3;1-2/h8-9H,5-7H2,1-4H3;1-2H3/t9-;/m1./s1.
What are the key properties of (3R)-2,3-dimethylheptane;ethane?
(3R)-2,3-dimethylheptane;ethane has a molecular weight of 158.33 g/mol, XLogP of 4.49, 4 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for (3R)-2,3-dimethylheptane;ethane is sourced from PubChem (CID 163241846), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).