About 6-ethyl-2,3-dimethyldecane
6-ethyl-2,3-dimethyldecane (PubChem CID 57491764) has the molecular formula C14H30
and a molecular weight of 198.39 g/mol. Its IUPAC name is 6-ethyl-2,3-dimethyldecane.
Molecular Properties
| Compound Name | 6-ethyl-2,3-dimethyldecane |
| PubChem CID | 57491764 |
| Molecular Formula | C14H30 |
| Molecular Weight | 198.39 g/mol |
| Exact Mass | 198.23 |
| IUPAC Name | 6-ethyl-2,3-dimethyldecane |
| SMILES | CCCCC(CC)CCC(C)C(C)C |
| InChI | InChI=1S/C14H30/c1-6-8-9-14(7-2)11-10-13(5)12(3)4/h12-14H,6-11H2,1-5H3 |
| InChIKey | BZBICHPTRJIJRU-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 198.39 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 6-ethyl-2,3-dimethyldecane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-ethyl-2,3-dimethyldecane?
The IUPAC name of 6-ethyl-2,3-dimethyldecane (CID 57491764) is 6-ethyl-2,3-dimethyldecane.
What is the SMILES notation for 6-ethyl-2,3-dimethyldecane?
The canonical SMILES for 6-ethyl-2,3-dimethyldecane is CCCCC(CC)CCC(C)C(C)C.
What is the InChIKey of 6-ethyl-2,3-dimethyldecane?
The InChIKey is BZBICHPTRJIJRU-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H30/c1-6-8-9-14(7-2)11-10-13(5)12(3)4/h12-14H,6-11H2,1-5H3.
What are the key properties of 6-ethyl-2,3-dimethyldecane?
6-ethyl-2,3-dimethyldecane has a molecular weight of 198.39 g/mol, XLogP of 5.28, 8 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 6-ethyl-2,3-dimethyldecane is sourced from PubChem (CID 57491764), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).