About 5-butyl-2,3-dimethylnonane
5-butyl-2,3-dimethylnonane (PubChem CID 123894711) has the molecular formula C15H32
and a molecular weight of 212.42 g/mol. Its IUPAC name is 5-butyl-2,3-dimethylnonane.
Molecular Properties
| Compound Name | 5-butyl-2,3-dimethylnonane |
| PubChem CID | 123894711 |
| Molecular Formula | C15H32 |
| Molecular Weight | 212.42 g/mol |
| Exact Mass | 212.25 |
| IUPAC Name | 5-butyl-2,3-dimethylnonane |
| SMILES | CCCCC(CCCC)CC(C)C(C)C |
| InChI | InChI=1S/C15H32/c1-6-8-10-15(11-9-7-2)12-14(5)13(3)4/h13-15H,6-12H2,1-5H3 |
| InChIKey | RGZSPVDVCHSBPA-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 9 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 212.42 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 5-butyl-2,3-dimethylnonane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-butyl-2,3-dimethylnonane?
The IUPAC name of 5-butyl-2,3-dimethylnonane (CID 123894711) is 5-butyl-2,3-dimethylnonane.
What is the SMILES notation for 5-butyl-2,3-dimethylnonane?
The canonical SMILES for 5-butyl-2,3-dimethylnonane is CCCCC(CCCC)CC(C)C(C)C.
What is the InChIKey of 5-butyl-2,3-dimethylnonane?
The InChIKey is RGZSPVDVCHSBPA-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H32/c1-6-8-10-15(11-9-7-2)12-14(5)13(3)4/h13-15H,6-12H2,1-5H3.
What are the key properties of 5-butyl-2,3-dimethylnonane?
5-butyl-2,3-dimethylnonane has a molecular weight of 212.42 g/mol, XLogP of 5.67, 9 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 5-butyl-2,3-dimethylnonane is sourced from PubChem (CID 123894711), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).