About 5,7-dibutylundecane;nonane
5,7-dibutylundecane;nonane (PubChem CID 159714693) has the molecular formula C28H60
and a molecular weight of 396.79 g/mol. Its IUPAC name is 5,7-dibutylundecane;nonane.
Molecular Properties
| Compound Name | 5,7-dibutylundecane;nonane |
| PubChem CID | 159714693 |
| Molecular Formula | C28H60 |
| Molecular Weight | 396.79 g/mol |
| Exact Mass | 396.47 |
| IUPAC Name | 5,7-dibutylundecane;nonane |
| SMILES | CCCCC(CCCC)CC(CCCC)CCCC.CCCCCCCCC |
| InChI | InChI=1S/C19H40.C9H20/c1-5-9-13-18(14-10-6-2)17-19(15-11-7-3)16-12-8-4;1-3-5-7-9-8-6-4-2/h18-19H,5-17H2,1-4H3;3-9H2,1-2H3 |
| InChIKey | MZGYVHASKZHZFW-UHFFFAOYSA-N |
| XLogP | 11.13 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 20 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 396.79 |
| LogP ≤ 5 | 11.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 5,7-dibutylundecane;nonane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,7-dibutylundecane;nonane?
The IUPAC name of 5,7-dibutylundecane;nonane (CID 159714693) is 5,7-dibutylundecane;nonane.
What is the SMILES notation for 5,7-dibutylundecane;nonane?
The canonical SMILES for 5,7-dibutylundecane;nonane is CCCCC(CCCC)CC(CCCC)CCCC.CCCCCCCCC.
What is the InChIKey of 5,7-dibutylundecane;nonane?
The InChIKey is MZGYVHASKZHZFW-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H40.C9H20/c1-5-9-13-18(14-10-6-2)17-19(15-11-7-3)16-12-8-4;1-3-5-7-9-8-6-4-2/h18-19H,5-17H2,1-4H3;3-9H2,1-2H3.
What are the key properties of 5,7-dibutylundecane;nonane?
5,7-dibutylundecane;nonane has a molecular weight of 396.79 g/mol, XLogP of 11.13, 20 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 5,7-dibutylundecane;nonane is sourced from PubChem (CID 159714693), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).