About 6-butyl-4,8-dipropylundecane
6-butyl-4,8-dipropylundecane (PubChem CID 158410657) has the molecular formula C21H44
and a molecular weight of 296.58 g/mol. Its IUPAC name is 6-butyl-4,8-dipropylundecane.
Molecular Properties
| Compound Name | 6-butyl-4,8-dipropylundecane |
| PubChem CID | 158410657 |
| Molecular Formula | C21H44 |
| Molecular Weight | 296.58 g/mol |
| Exact Mass | 296.34 |
| IUPAC Name | 6-butyl-4,8-dipropylundecane |
| SMILES | CCCCC(CC(CCC)CCC)CC(CCC)CCC |
| InChI | InChI=1S/C21H44/c1-6-11-16-21(17-19(12-7-2)13-8-3)18-20(14-9-4)15-10-5/h19-21H,6-18H2,1-5H3 |
| InChIKey | GZGPCVNMTHBOTH-UHFFFAOYSA-N |
| XLogP | 8.01 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 15 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 296.58 |
| LogP ≤ 5 | 8.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 6-butyl-4,8-dipropylundecane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-butyl-4,8-dipropylundecane?
The IUPAC name of 6-butyl-4,8-dipropylundecane (CID 158410657) is 6-butyl-4,8-dipropylundecane.
What is the SMILES notation for 6-butyl-4,8-dipropylundecane?
The canonical SMILES for 6-butyl-4,8-dipropylundecane is CCCCC(CC(CCC)CCC)CC(CCC)CCC.
What is the InChIKey of 6-butyl-4,8-dipropylundecane?
The InChIKey is GZGPCVNMTHBOTH-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H44/c1-6-11-16-21(17-19(12-7-2)13-8-3)18-20(14-9-4)15-10-5/h19-21H,6-18H2,1-5H3.
What are the key properties of 6-butyl-4,8-dipropylundecane?
6-butyl-4,8-dipropylundecane has a molecular weight of 296.58 g/mol, XLogP of 8.01, 15 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 6-butyl-4,8-dipropylundecane is sourced from PubChem (CID 158410657), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).