About 3,6-diethylundecane
3,6-diethylundecane (PubChem CID 22051817) has the molecular formula C15H32
and a molecular weight of 212.42 g/mol. Its IUPAC name is 3,6-diethylundecane.
Molecular Properties
| Compound Name | 3,6-diethylundecane |
| PubChem CID | 22051817 |
| Molecular Formula | C15H32 |
| Molecular Weight | 212.42 g/mol |
| Exact Mass | 212.25 |
| IUPAC Name | 3,6-diethylundecane |
| SMILES | CCCCCC(CC)CCC(CC)CC |
| InChI | InChI=1S/C15H32/c1-5-9-10-11-15(8-4)13-12-14(6-2)7-3/h14-15H,5-13H2,1-4H3 |
| InChIKey | VJEQJMOIMQQOER-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 10 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 212.42 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3,6-diethylundecane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,6-diethylundecane?
The IUPAC name of 3,6-diethylundecane (CID 22051817) is 3,6-diethylundecane.
What is the SMILES notation for 3,6-diethylundecane?
The canonical SMILES for 3,6-diethylundecane is CCCCCC(CC)CCC(CC)CC.
What is the InChIKey of 3,6-diethylundecane?
The InChIKey is VJEQJMOIMQQOER-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H32/c1-5-9-10-11-15(8-4)13-12-14(6-2)7-3/h14-15H,5-13H2,1-4H3.
What are the key properties of 3,6-diethylundecane?
3,6-diethylundecane has a molecular weight of 212.42 g/mol, XLogP of 5.81, 10 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 3,6-diethylundecane is sourced from PubChem (CID 22051817), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).