About 3-ethylicosane
3-ethylicosane (PubChem CID 528487) has the molecular formula C22H46
and a molecular weight of 310.61 g/mol. Its IUPAC name is 3-ethylicosane.
Molecular Properties
| Compound Name | 3-ethylicosane |
| PubChem CID | 528487 |
| Molecular Formula | C22H46 |
| Molecular Weight | 310.61 g/mol |
| Exact Mass | 310.36 |
| IUPAC Name | 3-ethylicosane |
| SMILES | CCCCCCCCCCCCCCCCCC(CC)CC |
| InChI | InChI=1S/C22H46/c1-4-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22(5-2)6-3/h22H,4-21H2,1-3H3 |
| InChIKey | PEOLXVKASMQSMY-UHFFFAOYSA-N |
| XLogP | 8.68 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 18 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 310.61 |
| LogP ≤ 5 | 8.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-ethylicosane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethylicosane?
The IUPAC name of 3-ethylicosane (CID 528487) is 3-ethylicosane.
What is the SMILES notation for 3-ethylicosane?
The canonical SMILES for 3-ethylicosane is CCCCCCCCCCCCCCCCCC(CC)CC.
What is the InChIKey of 3-ethylicosane?
The InChIKey is PEOLXVKASMQSMY-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H46/c1-4-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22(5-2)6-3/h22H,4-21H2,1-3H3.
What are the key properties of 3-ethylicosane?
3-ethylicosane has a molecular weight of 310.61 g/mol, XLogP of 8.68, 18 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethylicosane is sourced from PubChem (CID 528487), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).