About 7-ethyltridecane;methane
7-ethyltridecane;methane (PubChem CID 158982306) has the molecular formula C17H40
and a molecular weight of 244.51 g/mol. Its IUPAC name is 7-ethyltridecane;methane.
Molecular Properties
| Compound Name | 7-ethyltridecane;methane |
| PubChem CID | 158982306 |
| Molecular Formula | C17H40 |
| Molecular Weight | 244.51 g/mol |
| Exact Mass | 244.31 |
| IUPAC Name | 7-ethyltridecane;methane |
| SMILES | C.C.CCCCCCC(CC)CCCCCC |
| InChI | InChI=1S/C15H32.2CH4/c1-4-7-9-11-13-15(6-3)14-12-10-8-5-2;;/h15H,4-14H2,1-3H3;2*1H4 |
| InChIKey | JPDQBTCETLFOJN-UHFFFAOYSA-N |
| XLogP | 7.23 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 11 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 244.51 |
| LogP ≤ 5 | 7.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 7-ethyltridecane;methane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-ethyltridecane;methane?
The IUPAC name of 7-ethyltridecane;methane (CID 158982306) is 7-ethyltridecane;methane.
What is the SMILES notation for 7-ethyltridecane;methane?
The canonical SMILES for 7-ethyltridecane;methane is C.C.CCCCCCC(CC)CCCCCC.
What is the InChIKey of 7-ethyltridecane;methane?
The InChIKey is JPDQBTCETLFOJN-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H32.2CH4/c1-4-7-9-11-13-15(6-3)14-12-10-8-5-2;;/h15H,4-14H2,1-3H3;2*1H4.
What are the key properties of 7-ethyltridecane;methane?
7-ethyltridecane;methane has a molecular weight of 244.51 g/mol, XLogP of 7.23, 11 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 7-ethyltridecane;methane is sourced from PubChem (CID 158982306), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).