About ethane;3-ethylundecane
ethane;3-ethylundecane (PubChem CID 144815521) has the molecular formula C19H46
and a molecular weight of 274.58 g/mol. Its IUPAC name is ethane;3-ethylundecane.
Molecular Properties
| Compound Name | ethane;3-ethylundecane |
| PubChem CID | 144815521 |
| Molecular Formula | C19H46 |
| Molecular Weight | 274.58 g/mol |
| Exact Mass | 274.36 |
| IUPAC Name | ethane;3-ethylundecane |
| SMILES | CC.CC.CC.CCCCCCCCC(CC)CC |
| InChI | InChI=1S/C13H28.3C2H6/c1-4-7-8-9-10-11-12-13(5-2)6-3;3*1-2/h13H,4-12H2,1-3H3;3*1-2H3 |
| InChIKey | QVEXBDOKPBZCGK-UHFFFAOYSA-N |
| XLogP | 8.25 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 274.58 |
| LogP ≤ 5 | 8.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze ethane;3-ethylundecane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;3-ethylundecane?
The IUPAC name of ethane;3-ethylundecane (CID 144815521) is ethane;3-ethylundecane.
What is the SMILES notation for ethane;3-ethylundecane?
The canonical SMILES for ethane;3-ethylundecane is CC.CC.CC.CCCCCCCCC(CC)CC.
What is the InChIKey of ethane;3-ethylundecane?
The InChIKey is QVEXBDOKPBZCGK-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H28.3C2H6/c1-4-7-8-9-10-11-12-13(5-2)6-3;3*1-2/h13H,4-12H2,1-3H3;3*1-2H3.
What are the key properties of ethane;3-ethylundecane?
ethane;3-ethylundecane has a molecular weight of 274.58 g/mol, XLogP of 8.25, 9 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;3-ethylundecane is sourced from PubChem (CID 144815521), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).