About 4-ethylhexadecane
4-ethylhexadecane (PubChem CID 528433) has the molecular formula C18H38
and a molecular weight of 254.50 g/mol. Its IUPAC name is 4-ethylhexadecane.
Molecular Properties
| Compound Name | 4-ethylhexadecane |
| PubChem CID | 528433 |
| Molecular Formula | C18H38 |
| Molecular Weight | 254.50 g/mol |
| Exact Mass | 254.30 |
| IUPAC Name | 4-ethylhexadecane |
| SMILES | CCCCCCCCCCCCC(CC)CCC |
| InChI | InChI=1S/C18H38/c1-4-7-8-9-10-11-12-13-14-15-17-18(6-3)16-5-2/h18H,4-17H2,1-3H3 |
| InChIKey | CAJDQYQXSQLIEL-UHFFFAOYSA-N |
| XLogP | 7.12 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 14 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 254.50 |
| LogP ≤ 5 | 7.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-ethylhexadecane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-ethylhexadecane?
The IUPAC name of 4-ethylhexadecane (CID 528433) is 4-ethylhexadecane.
What is the SMILES notation for 4-ethylhexadecane?
The canonical SMILES for 4-ethylhexadecane is CCCCCCCCCCCCC(CC)CCC.
What is the InChIKey of 4-ethylhexadecane?
The InChIKey is CAJDQYQXSQLIEL-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H38/c1-4-7-8-9-10-11-12-13-14-15-17-18(6-3)16-5-2/h18H,4-17H2,1-3H3.
What are the key properties of 4-ethylhexadecane?
4-ethylhexadecane has a molecular weight of 254.50 g/mol, XLogP of 7.12, 14 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 4-ethylhexadecane is sourced from PubChem (CID 528433), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).