About 4-ethylnonadecane
4-ethylnonadecane (PubChem CID 22223766) has the molecular formula C21H44
and a molecular weight of 296.58 g/mol. Its IUPAC name is 4-ethylnonadecane.
Molecular Properties
| Compound Name | 4-ethylnonadecane |
| PubChem CID | 22223766 |
| Molecular Formula | C21H44 |
| Molecular Weight | 296.58 g/mol |
| Exact Mass | 296.34 |
| IUPAC Name | 4-ethylnonadecane |
| SMILES | CCCCCCCCCCCCCCCC(CC)CCC |
| InChI | InChI=1S/C21H44/c1-4-7-8-9-10-11-12-13-14-15-16-17-18-20-21(6-3)19-5-2/h21H,4-20H2,1-3H3 |
| InChIKey | LMKPWTVDPGYDOC-UHFFFAOYSA-N |
| XLogP | 8.29 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 17 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 296.58 |
| LogP ≤ 5 | 8.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-ethylnonadecane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-ethylnonadecane?
The IUPAC name of 4-ethylnonadecane (CID 22223766) is 4-ethylnonadecane.
What is the SMILES notation for 4-ethylnonadecane?
The canonical SMILES for 4-ethylnonadecane is CCCCCCCCCCCCCCCC(CC)CCC.
What is the InChIKey of 4-ethylnonadecane?
The InChIKey is LMKPWTVDPGYDOC-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H44/c1-4-7-8-9-10-11-12-13-14-15-16-17-18-20-21(6-3)19-5-2/h21H,4-20H2,1-3H3.
What are the key properties of 4-ethylnonadecane?
4-ethylnonadecane has a molecular weight of 296.58 g/mol, XLogP of 8.29, 17 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 4-ethylnonadecane is sourced from PubChem (CID 22223766), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).