About 3-ethyldodecane;bis(N-ethylethanamine)
3-ethyldodecane;bis(N-ethylethanamine) (PubChem CID 160952353) has the molecular formula C22H52N2
and a molecular weight of 344.67 g/mol. Its IUPAC name is 3-ethyldodecane;bis(N-ethylethanamine).
Molecular Properties
| Compound Name | 3-ethyldodecane;bis(N-ethylethanamine) |
| PubChem CID | 160952353 |
| Molecular Formula | C22H52N2 |
| Molecular Weight | 344.67 g/mol |
| Exact Mass | 344.41 |
| IUPAC Name | 3-ethyldodecane;bis(N-ethylethanamine) |
| SMILES | CCCCCCCCCC(CC)CC.CCNCC.CCNCC |
| InChI | InChI=1S/C14H30.2C4H11N/c1-4-7-8-9-10-11-12-13-14(5-2)6-3;2*1-3-5-4-2/h14H,4-13H2,1-3H3;2*5H,3-4H2,1-2H3 |
| InChIKey | SVXSYBJNKCXWPH-UHFFFAOYSA-N |
| XLogP | 6.79 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 344.67 |
| LogP ≤ 5 | 6.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-ethyldodecane;bis(N-ethylethanamine) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethyldodecane;bis(N-ethylethanamine)?
The IUPAC name of 3-ethyldodecane;bis(N-ethylethanamine) (CID 160952353) is 3-ethyldodecane;bis(N-ethylethanamine).
What is the SMILES notation for 3-ethyldodecane;bis(N-ethylethanamine)?
The canonical SMILES for 3-ethyldodecane;bis(N-ethylethanamine) is CCCCCCCCCC(CC)CC.CCNCC.CCNCC.
What is the InChIKey of 3-ethyldodecane;bis(N-ethylethanamine)?
The InChIKey is SVXSYBJNKCXWPH-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H30.2C4H11N/c1-4-7-8-9-10-11-12-13-14(5-2)6-3;2*1-3-5-4-2/h14H,4-13H2,1-3H3;2*5H,3-4H2,1-2H3.
What are the key properties of 3-ethyldodecane;bis(N-ethylethanamine)?
3-ethyldodecane;bis(N-ethylethanamine) has a molecular weight of 344.67 g/mol, XLogP of 6.79, 14 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethyldodecane;bis(N-ethylethanamine) is sourced from PubChem (CID 160952353), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).