About butane;ethane;3-methylheptan-2-ol
butane;ethane;3-methylheptan-2-ol (PubChem CID 176696047) has the molecular formula C18H44O
and a molecular weight of 276.55 g/mol. Its IUPAC name is butane;ethane;3-methylheptan-2-ol.
Molecular Properties
| Compound Name | butane;ethane;3-methylheptan-2-ol |
| PubChem CID | 176696047 |
| Molecular Formula | C18H44O |
| Molecular Weight | 276.55 g/mol |
| Exact Mass | 276.34 |
| IUPAC Name | butane;ethane;3-methylheptan-2-ol |
| SMILES | CC.CCCC.CCCC.CCCCC(C)C(C)O |
| InChI | InChI=1S/C8H18O.2C4H10.C2H6/c1-4-5-6-7(2)8(3)9;2*1-3-4-2;1-2/h7-9H,4-6H2,1-3H3;2*3-4H2,1-2H3;1-2H3 |
| InChIKey | JAHKOTVTSKAGCY-UHFFFAOYSA-N |
| XLogP | 6.83 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 276.55 |
| LogP ≤ 5 | 6.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze butane;ethane;3-methylheptan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butane;ethane;3-methylheptan-2-ol?
The IUPAC name of butane;ethane;3-methylheptan-2-ol (CID 176696047) is butane;ethane;3-methylheptan-2-ol.
What is the SMILES notation for butane;ethane;3-methylheptan-2-ol?
The canonical SMILES for butane;ethane;3-methylheptan-2-ol is CC.CCCC.CCCC.CCCCC(C)C(C)O.
What is the InChIKey of butane;ethane;3-methylheptan-2-ol?
The InChIKey is JAHKOTVTSKAGCY-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H18O.2C4H10.C2H6/c1-4-5-6-7(2)8(3)9;2*1-3-4-2;1-2/h7-9H,4-6H2,1-3H3;2*3-4H2,1-2H3;1-2H3.
What are the key properties of butane;ethane;3-methylheptan-2-ol?
butane;ethane;3-methylheptan-2-ol has a molecular weight of 276.55 g/mol, XLogP of 6.83, 6 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for butane;ethane;3-methylheptan-2-ol is sourced from PubChem (CID 176696047), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).