C7H16O2 — CID 124511959
(4S,5S)-4-methylhexane-1,5-diol (PubChem CID 124511959) has the molecular formula C7H16O2 and a molecular weight of 132.20 g/mol. Its IUPAC name is (4S,5S)-4-methylhexane-1,5-diol.
| Compound Name | (4S,5S)-4-methylhexane-1,5-diol |
|---|---|
| PubChem CID | 124511959 |
| Molecular Formula | C7H16O2 |
| Molecular Weight | 132.20 g/mol |
| Exact Mass | 132.12 |
| IUPAC Name | (4S,5S)-4-methylhexane-1,5-diol |
| SMILES | C[C@H](O)[C@@H](C)CCCO |
| InChI | InChI=1S/C7H16O2/c1-6(7(2)9)4-3-5-8/h6-9H,3-5H2,1-2H3/t6-,7-/m0/s1 |
| InChIKey | JPAIHHDYGSYVPR-BQBZGAKWSA-N |
| XLogP | 0.78 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 132.20 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |