C13H28O — CID 15548643
(2S,3R,7R)-3,7-dimethylundecan-2-ol (PubChem CID 15548643) has the molecular formula C13H28O and a molecular weight of 200.37 g/mol. Its IUPAC name is (2S,3R,7R)-3,7-dimethylundecan-2-ol.
| Compound Name | (2S,3R,7R)-3,7-dimethylundecan-2-ol |
|---|---|
| PubChem CID | 15548643 |
| Molecular Formula | C13H28O |
| Molecular Weight | 200.37 g/mol |
| Exact Mass | 200.21 |
| IUPAC Name | (2S,3R,7R)-3,7-dimethylundecan-2-ol |
| SMILES | CCCC[C@@H](C)CCC[C@@H](C)[C@H](C)O |
| InChI | InChI=1S/C13H28O/c1-5-6-8-11(2)9-7-10-12(3)13(4)14/h11-14H,5-10H2,1-4H3/t11-,12-,13+/m1/s1 |
| InChIKey | MBAGMBOUGRRZPN-UPJWGTAASA-N |
| XLogP | 4.00 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.37 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |