C15H32O — CID 15981575
(2S,3R,7R)-3,7-dimethyltridecan-2-ol (PubChem CID 15981575) has the molecular formula C15H32O and a molecular weight of 228.42 g/mol. Its IUPAC name is (2S,3R,7R)-3,7-dimethyltridecan-2-ol.
| Compound Name | (2S,3R,7R)-3,7-dimethyltridecan-2-ol |
|---|---|
| PubChem CID | 15981575 |
| Molecular Formula | C15H32O |
| Molecular Weight | 228.42 g/mol |
| Exact Mass | 228.25 |
| IUPAC Name | (2S,3R,7R)-3,7-dimethyltridecan-2-ol |
| SMILES | CCCCCC[C@@H](C)CCC[C@@H](C)[C@H](C)O |
| InChI | InChI=1S/C15H32O/c1-5-6-7-8-10-13(2)11-9-12-14(3)15(4)16/h13-16H,5-12H2,1-4H3/t13-,14-,15+/m1/s1 |
| InChIKey | GSOHTXXXDWFCAJ-KFWWJZLASA-N |
| XLogP | 4.78 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.42 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|