About 3-methylbutan-1-ol;3-methylbutan-2-ol;4-methylpentan-1-ol
3-methylbutan-1-ol;3-methylbutan-2-ol;4-methylpentan-1-ol (PubChem CID 159995957) has the molecular formula C16H38O3
and a molecular weight of 278.48 g/mol. Its IUPAC name is 3-methylbutan-1-ol;3-methylbutan-2-ol;4-methylpentan-1-ol.
Molecular Properties
| Compound Name | 3-methylbutan-1-ol;3-methylbutan-2-ol;4-methylpentan-1-ol |
| PubChem CID | 159995957 |
| Molecular Formula | C16H38O3 |
| Molecular Weight | 278.48 g/mol |
| Exact Mass | 278.28 |
| IUPAC Name | 3-methylbutan-1-ol;3-methylbutan-2-ol;4-methylpentan-1-ol |
| SMILES | CC(C)C(C)O.CC(C)CCCO.CC(C)CCO |
| InChI | InChI=1S/C6H14O.2C5H12O/c1-6(2)4-3-5-7;1-5(2)3-4-6;1-4(2)5(3)6/h6-7H,3-5H2,1-2H3;5-6H,3-4H2,1-2H3;4-6H,1-3H3 |
| InChIKey | OHNRYIJKMCZHKL-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.48 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-methylbutan-1-ol;3-methylbutan-2-ol;4-methylpentan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methylbutan-1-ol;3-methylbutan-2-ol;4-methylpentan-1-ol?
The IUPAC name of 3-methylbutan-1-ol;3-methylbutan-2-ol;4-methylpentan-1-ol (CID 159995957) is 3-methylbutan-1-ol;3-methylbutan-2-ol;4-methylpentan-1-ol.
What is the SMILES notation for 3-methylbutan-1-ol;3-methylbutan-2-ol;4-methylpentan-1-ol?
The canonical SMILES for 3-methylbutan-1-ol;3-methylbutan-2-ol;4-methylpentan-1-ol is CC(C)C(C)O.CC(C)CCCO.CC(C)CCO.
What is the InChIKey of 3-methylbutan-1-ol;3-methylbutan-2-ol;4-methylpentan-1-ol?
The InChIKey is OHNRYIJKMCZHKL-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H14O.2C5H12O/c1-6(2)4-3-5-7;1-5(2)3-4-6;1-4(2)5(3)6/h6-7H,3-5H2,1-2H3;5-6H,3-4H2,1-2H3;4-6H,1-3H3.
What are the key properties of 3-methylbutan-1-ol;3-methylbutan-2-ol;4-methylpentan-1-ol?
3-methylbutan-1-ol;3-methylbutan-2-ol;4-methylpentan-1-ol has a molecular weight of 278.48 g/mol, XLogP of 3.46, 6 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methylbutan-1-ol;3-methylbutan-2-ol;4-methylpentan-1-ol is sourced from PubChem (CID 159995957), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).