About calcium;hydride;3-methylbutan-1-ol
calcium;hydride;3-methylbutan-1-ol (PubChem CID 174734037) has the molecular formula C5H14CaO
and a molecular weight of 130.24 g/mol. Its IUPAC name is calcium;hydride;3-methylbutan-1-ol.
Molecular Properties
| Compound Name | calcium;hydride;3-methylbutan-1-ol |
| PubChem CID | 174734037 |
| Molecular Formula | C5H14CaO |
| Molecular Weight | 130.24 g/mol |
| Exact Mass | 130.07 |
| IUPAC Name | calcium;hydride;3-methylbutan-1-ol |
| SMILES | CC(C)CCO.[Ca+2].[H-].[H-] |
| InChI | InChI=1S/C5H12O.Ca.2H/c1-5(2)3-4-6;;;/h5-6H,3-4H2,1-2H3;;;/q;+2;2*-1 |
| InChIKey | HTHXJJKXKANREM-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 130.24 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze calcium;hydride;3-methylbutan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of calcium;hydride;3-methylbutan-1-ol?
The IUPAC name of calcium;hydride;3-methylbutan-1-ol (CID 174734037) is calcium;hydride;3-methylbutan-1-ol.
What is the SMILES notation for calcium;hydride;3-methylbutan-1-ol?
The canonical SMILES for calcium;hydride;3-methylbutan-1-ol is CC(C)CCO.[Ca+2].[H-].[H-].
What is the InChIKey of calcium;hydride;3-methylbutan-1-ol?
The InChIKey is HTHXJJKXKANREM-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H12O.Ca.2H/c1-5(2)3-4-6;;;/h5-6H,3-4H2,1-2H3;;;/q;+2;2*-1.
What are the key properties of calcium;hydride;3-methylbutan-1-ol?
calcium;hydride;3-methylbutan-1-ol has a molecular weight of 130.24 g/mol, XLogP of 0.87, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for calcium;hydride;3-methylbutan-1-ol is sourced from PubChem (CID 174734037), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).