About chloroform;3-methylbutan-1-ol
chloroform;3-methylbutan-1-ol (PubChem CID 173101838) has the molecular formula C29H36Cl72O
and a molecular weight of 2953.22 g/mol. Its IUPAC name is chloroform;3-methylbutan-1-ol.
Molecular Properties
| Compound Name | chloroform;3-methylbutan-1-ol |
| PubChem CID | 173101838 |
| Molecular Formula | C29H36Cl72O |
| Molecular Weight | 2953.22 g/mol |
| Exact Mass | 2918.03 |
| IUPAC Name | chloroform;3-methylbutan-1-ol |
| SMILES | CC(C)CCO.ClC(Cl)Cl.ClC(Cl)Cl.ClC(Cl)Cl.ClC(Cl)Cl.ClC(Cl)Cl.ClC(Cl)Cl.ClC(Cl)Cl.ClC(Cl)Cl.ClC(Cl)Cl.ClC(Cl)Cl.ClC(Cl)Cl.ClC(Cl)Cl.ClC(Cl)Cl.ClC(Cl)Cl.ClC(Cl)Cl.ClC(Cl)Cl.ClC(Cl)Cl.ClC(Cl)Cl.ClC(Cl)Cl.ClC(Cl)Cl.ClC(Cl)Cl.ClC(Cl)Cl.ClC(Cl)Cl.ClC(Cl)Cl |
| InChI | InChI=1S/C5H12O.24CHCl3/c1-5(2)3-4-6;24*2-1(3)4/h5-6H,3-4H2,1-2H3;24*1H |
| InChIKey | CSNGCTYDDPPWQE-UHFFFAOYSA-N |
| XLogP | 48.70 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 102 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 2953.22 |
| LogP ≤ 5 | 48.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze chloroform;3-methylbutan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of chloroform;3-methylbutan-1-ol?
The IUPAC name of chloroform;3-methylbutan-1-ol (CID 173101838) is chloroform;3-methylbutan-1-ol.
What is the SMILES notation for chloroform;3-methylbutan-1-ol?
The canonical SMILES for chloroform;3-methylbutan-1-ol is CC(C)CCO.ClC(Cl)Cl.ClC(Cl)Cl.ClC(Cl)Cl.ClC(Cl)Cl.ClC(Cl)Cl.ClC(Cl)Cl.ClC(Cl)Cl.ClC(Cl)Cl.ClC(Cl)Cl.ClC(Cl)Cl.ClC(Cl)Cl.ClC(Cl)Cl.ClC(Cl)Cl.ClC(Cl)Cl.ClC(Cl)Cl.ClC(Cl)Cl.ClC(Cl)Cl.ClC(Cl)Cl.ClC(Cl)Cl.ClC(Cl)Cl.ClC(Cl)Cl.ClC(Cl)Cl.ClC(Cl)Cl.ClC(Cl)Cl.
What is the InChIKey of chloroform;3-methylbutan-1-ol?
The InChIKey is CSNGCTYDDPPWQE-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H12O.24CHCl3/c1-5(2)3-4-6;24*2-1(3)4/h5-6H,3-4H2,1-2H3;24*1H.
What are the key properties of chloroform;3-methylbutan-1-ol?
chloroform;3-methylbutan-1-ol has a molecular weight of 2953.22 g/mol, XLogP of 48.70, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for chloroform;3-methylbutan-1-ol is sourced from PubChem (CID 173101838), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).