About butan-1-ol;dichloromethane;3-methylbutan-1-ol
butan-1-ol;dichloromethane;3-methylbutan-1-ol (PubChem CID 174966055) has the molecular formula C10H24Cl2O2
and a molecular weight of 247.21 g/mol. Its IUPAC name is butan-1-ol;dichloromethane;3-methylbutan-1-ol.
Molecular Properties
| Compound Name | butan-1-ol;dichloromethane;3-methylbutan-1-ol |
| PubChem CID | 174966055 |
| Molecular Formula | C10H24Cl2O2 |
| Molecular Weight | 247.21 g/mol |
| Exact Mass | 246.12 |
| IUPAC Name | butan-1-ol;dichloromethane;3-methylbutan-1-ol |
| SMILES | CC(C)CCO.CCCCO.ClCCl |
| InChI | InChI=1S/C5H12O.C4H10O.CH2Cl2/c1-5(2)3-4-6;1-2-3-4-5;2-1-3/h5-6H,3-4H2,1-2H3;5H,2-4H2,1H3;1H2 |
| InChIKey | SVNOTOPMTNZKHU-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 247.21 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze butan-1-ol;dichloromethane;3-methylbutan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butan-1-ol;dichloromethane;3-methylbutan-1-ol?
The IUPAC name of butan-1-ol;dichloromethane;3-methylbutan-1-ol (CID 174966055) is butan-1-ol;dichloromethane;3-methylbutan-1-ol.
What is the SMILES notation for butan-1-ol;dichloromethane;3-methylbutan-1-ol?
The canonical SMILES for butan-1-ol;dichloromethane;3-methylbutan-1-ol is CC(C)CCO.CCCCO.ClCCl.
What is the InChIKey of butan-1-ol;dichloromethane;3-methylbutan-1-ol?
The InChIKey is SVNOTOPMTNZKHU-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H12O.C4H10O.CH2Cl2/c1-5(2)3-4-6;1-2-3-4-5;2-1-3/h5-6H,3-4H2,1-2H3;5H,2-4H2,1H3;1H2.
What are the key properties of butan-1-ol;dichloromethane;3-methylbutan-1-ol?
butan-1-ol;dichloromethane;3-methylbutan-1-ol has a molecular weight of 247.21 g/mol, XLogP of 3.23, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for butan-1-ol;dichloromethane;3-methylbutan-1-ol is sourced from PubChem (CID 174966055), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).