About ethane;3-methylbutan-1-ol;propane
ethane;3-methylbutan-1-ol;propane (PubChem CID 163391548) has the molecular formula C10H26O
and a molecular weight of 162.32 g/mol. Its IUPAC name is ethane;3-methylbutan-1-ol;propane.
Molecular Properties
| Compound Name | ethane;3-methylbutan-1-ol;propane |
| PubChem CID | 163391548 |
| Molecular Formula | C10H26O |
| Molecular Weight | 162.32 g/mol |
| Exact Mass | 162.20 |
| IUPAC Name | ethane;3-methylbutan-1-ol;propane |
| SMILES | CC.CC(C)CCO.CCC |
| InChI | InChI=1S/C5H12O.C3H8.C2H6/c1-5(2)3-4-6;1-3-2;1-2/h5-6H,3-4H2,1-2H3;3H2,1-2H3;1-2H3 |
| InChIKey | NJKHDVKEHHHLEP-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 162.32 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze ethane;3-methylbutan-1-ol;propane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;3-methylbutan-1-ol;propane?
The IUPAC name of ethane;3-methylbutan-1-ol;propane (CID 163391548) is ethane;3-methylbutan-1-ol;propane.
What is the SMILES notation for ethane;3-methylbutan-1-ol;propane?
The canonical SMILES for ethane;3-methylbutan-1-ol;propane is CC.CC(C)CCO.CCC.
What is the InChIKey of ethane;3-methylbutan-1-ol;propane?
The InChIKey is NJKHDVKEHHHLEP-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H12O.C3H8.C2H6/c1-5(2)3-4-6;1-3-2;1-2/h5-6H,3-4H2,1-2H3;3H2,1-2H3;1-2H3.
What are the key properties of ethane;3-methylbutan-1-ol;propane?
ethane;3-methylbutan-1-ol;propane has a molecular weight of 162.32 g/mol, XLogP of 3.47, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;3-methylbutan-1-ol;propane is sourced from PubChem (CID 163391548), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).