About acetonitrile;3-methylbutan-1-ol
acetonitrile;3-methylbutan-1-ol (PubChem CID 161349190) has the molecular formula C7H15NO
and a molecular weight of 129.20 g/mol. Its IUPAC name is acetonitrile;3-methylbutan-1-ol.
Molecular Properties
| Compound Name | acetonitrile;3-methylbutan-1-ol |
| PubChem CID | 161349190 |
| Molecular Formula | C7H15NO |
| Molecular Weight | 129.20 g/mol |
| Exact Mass | 129.12 |
| IUPAC Name | acetonitrile;3-methylbutan-1-ol |
| SMILES | CC#N.CC(C)CCO |
| InChI | InChI=1S/C5H12O.C2H3N/c1-5(2)3-4-6;1-2-3/h5-6H,3-4H2,1-2H3;1H3 |
| InChIKey | VNSCWDKMYLBXJM-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 44.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 129.20 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze acetonitrile;3-methylbutan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetonitrile;3-methylbutan-1-ol?
The IUPAC name of acetonitrile;3-methylbutan-1-ol (CID 161349190) is acetonitrile;3-methylbutan-1-ol.
What is the SMILES notation for acetonitrile;3-methylbutan-1-ol?
The canonical SMILES for acetonitrile;3-methylbutan-1-ol is CC#N.CC(C)CCO.
What is the InChIKey of acetonitrile;3-methylbutan-1-ol?
The InChIKey is VNSCWDKMYLBXJM-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H12O.C2H3N/c1-5(2)3-4-6;1-2-3/h5-6H,3-4H2,1-2H3;1H3.
What are the key properties of acetonitrile;3-methylbutan-1-ol?
acetonitrile;3-methylbutan-1-ol has a molecular weight of 129.20 g/mol, XLogP of 1.55, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for acetonitrile;3-methylbutan-1-ol is sourced from PubChem (CID 161349190), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).