About 2-methylbutan-2-ol;3-methylbutan-1-ol
2-methylbutan-2-ol;3-methylbutan-1-ol (PubChem CID 159050772) has the molecular formula C10H24O2
and a molecular weight of 176.30 g/mol. Its IUPAC name is 2-methylbutan-2-ol;3-methylbutan-1-ol.
Molecular Properties
| Compound Name | 2-methylbutan-2-ol;3-methylbutan-1-ol |
| PubChem CID | 159050772 |
| Molecular Formula | C10H24O2 |
| Molecular Weight | 176.30 g/mol |
| Exact Mass | 176.18 |
| IUPAC Name | 2-methylbutan-2-ol;3-methylbutan-1-ol |
| SMILES | CC(C)CCO.CCC(C)(C)O |
| InChI | InChI=1S/2C5H12O/c1-5(2)3-4-6;1-4-5(2,3)6/h5-6H,3-4H2,1-2H3;6H,4H2,1-3H3 |
| InChIKey | JXFVFXCHFQOHGS-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 176.30 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-methylbutan-2-ol;3-methylbutan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylbutan-2-ol;3-methylbutan-1-ol?
The IUPAC name of 2-methylbutan-2-ol;3-methylbutan-1-ol (CID 159050772) is 2-methylbutan-2-ol;3-methylbutan-1-ol.
What is the SMILES notation for 2-methylbutan-2-ol;3-methylbutan-1-ol?
The canonical SMILES for 2-methylbutan-2-ol;3-methylbutan-1-ol is CC(C)CCO.CCC(C)(C)O.
What is the InChIKey of 2-methylbutan-2-ol;3-methylbutan-1-ol?
The InChIKey is JXFVFXCHFQOHGS-UHFFFAOYSA-N. The full InChI is InChI=1S/2C5H12O/c1-5(2)3-4-6;1-4-5(2,3)6/h5-6H,3-4H2,1-2H3;6H,4H2,1-3H3.
What are the key properties of 2-methylbutan-2-ol;3-methylbutan-1-ol?
2-methylbutan-2-ol;3-methylbutan-1-ol has a molecular weight of 176.30 g/mol, XLogP of 2.19, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylbutan-2-ol;3-methylbutan-1-ol is sourced from PubChem (CID 159050772), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).