About bis(3-methylbutan-1-ol);sulfuric acid
bis(3-methylbutan-1-ol);sulfuric acid (PubChem CID 71441144) has the molecular formula C10H26O6S
and a molecular weight of 274.38 g/mol. Its IUPAC name is bis(3-methylbutan-1-ol);sulfuric acid.
Molecular Properties
| Compound Name | bis(3-methylbutan-1-ol);sulfuric acid |
| PubChem CID | 71441144 |
| Molecular Formula | C10H26O6S |
| Molecular Weight | 274.38 g/mol |
| Exact Mass | 274.15 |
| IUPAC Name | bis(3-methylbutan-1-ol);sulfuric acid |
| SMILES | CC(C)CCO.CC(C)CCO.O=S(=O)(O)O |
| InChI | InChI=1S/2C5H12O.H2O4S/c2*1-5(2)3-4-6;1-5(2,3)4/h2*5-6H,3-4H2,1-2H3;(H2,1,2,3,4) |
| InChIKey | TUVISLXIHOQKRQ-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 115.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 274.38 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze bis(3-methylbutan-1-ol);sulfuric acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(3-methylbutan-1-ol);sulfuric acid?
The IUPAC name of bis(3-methylbutan-1-ol);sulfuric acid (CID 71441144) is bis(3-methylbutan-1-ol);sulfuric acid.
What is the SMILES notation for bis(3-methylbutan-1-ol);sulfuric acid?
The canonical SMILES for bis(3-methylbutan-1-ol);sulfuric acid is CC(C)CCO.CC(C)CCO.O=S(=O)(O)O.
What is the InChIKey of bis(3-methylbutan-1-ol);sulfuric acid?
The InChIKey is TUVISLXIHOQKRQ-UHFFFAOYSA-N. The full InChI is InChI=1S/2C5H12O.H2O4S/c2*1-5(2)3-4-6;1-5(2,3)4/h2*5-6H,3-4H2,1-2H3;(H2,1,2,3,4).
What are the key properties of bis(3-methylbutan-1-ol);sulfuric acid?
bis(3-methylbutan-1-ol);sulfuric acid has a molecular weight of 274.38 g/mol, XLogP of 1.40, 4 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for bis(3-methylbutan-1-ol);sulfuric acid is sourced from PubChem (CID 71441144), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).