About sulfuric acid;tetramethylphosphanium
sulfuric acid;tetramethylphosphanium (PubChem CID 87132357) has the molecular formula C4H14O4PS+
and a molecular weight of 189.19 g/mol. Its IUPAC name is sulfuric acid;tetramethylphosphanium.
Molecular Properties
| Compound Name | sulfuric acid;tetramethylphosphanium |
| PubChem CID | 87132357 |
| Molecular Formula | C4H14O4PS+ |
| Molecular Weight | 189.19 g/mol |
| Exact Mass | 189.03 |
| IUPAC Name | sulfuric acid;tetramethylphosphanium |
| SMILES | C[P+](C)(C)C.O=S(=O)(O)O |
| InChI | InChI=1S/C4H12P.H2O4S/c2*1-5(2,3)4/h1-4H3;(H2,1,2,3,4)/q+1; |
| InChIKey | NCIGEKFXLAUXKR-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 189.19 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze sulfuric acid;tetramethylphosphanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sulfuric acid;tetramethylphosphanium?
The IUPAC name of sulfuric acid;tetramethylphosphanium (CID 87132357) is sulfuric acid;tetramethylphosphanium.
What is the SMILES notation for sulfuric acid;tetramethylphosphanium?
The canonical SMILES for sulfuric acid;tetramethylphosphanium is C[P+](C)(C)C.O=S(=O)(O)O.
What is the InChIKey of sulfuric acid;tetramethylphosphanium?
The InChIKey is NCIGEKFXLAUXKR-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H12P.H2O4S/c2*1-5(2,3)4/h1-4H3;(H2,1,2,3,4)/q+1;.
What are the key properties of sulfuric acid;tetramethylphosphanium?
sulfuric acid;tetramethylphosphanium has a molecular weight of 189.19 g/mol, XLogP of 0.87, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for sulfuric acid;tetramethylphosphanium is sourced from PubChem (CID 87132357), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).