About azane;propan-2-ol;sulfuric acid
azane;propan-2-ol;sulfuric acid (PubChem CID 174667034) has the molecular formula C3H16N2O5S
and a molecular weight of 192.24 g/mol. Its IUPAC name is azane;propan-2-ol;sulfuric acid.
Molecular Properties
| Compound Name | azane;propan-2-ol;sulfuric acid |
| PubChem CID | 174667034 |
| Molecular Formula | C3H16N2O5S |
| Molecular Weight | 192.24 g/mol |
| Exact Mass | 192.08 |
| IUPAC Name | azane;propan-2-ol;sulfuric acid |
| SMILES | CC(C)O.N.N.O=S(=O)(O)O |
| InChI | InChI=1S/C3H8O.2H3N.H2O4S/c1-3(2)4;;;1-5(2,3)4/h3-4H,1-2H3;2*1H3;(H2,1,2,3,4) |
| InChIKey | FVILXCDUXVISBK-UHFFFAOYSA-N |
| XLogP | 0.06 |
| TPSA | 164.83 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.24 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze azane;propan-2-ol;sulfuric acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azane;propan-2-ol;sulfuric acid?
The IUPAC name of azane;propan-2-ol;sulfuric acid (CID 174667034) is azane;propan-2-ol;sulfuric acid.
What is the SMILES notation for azane;propan-2-ol;sulfuric acid?
The canonical SMILES for azane;propan-2-ol;sulfuric acid is CC(C)O.N.N.O=S(=O)(O)O.
What is the InChIKey of azane;propan-2-ol;sulfuric acid?
The InChIKey is FVILXCDUXVISBK-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H8O.2H3N.H2O4S/c1-3(2)4;;;1-5(2,3)4/h3-4H,1-2H3;2*1H3;(H2,1,2,3,4).
What are the key properties of azane;propan-2-ol;sulfuric acid?
azane;propan-2-ol;sulfuric acid has a molecular weight of 192.24 g/mol, XLogP of 0.06, 0 rotatable bonds, 5 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for azane;propan-2-ol;sulfuric acid is sourced from PubChem (CID 174667034), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).