C3H14O14S3 — CID 173459589
propane-1,2-diol;sulfuric acid (PubChem CID 173459589) has the molecular formula C3H14O14S3 and a molecular weight of 370.33 g/mol. Its IUPAC name is propane-1,2-diol;sulfuric acid.
| Compound Name | propane-1,2-diol;sulfuric acid |
|---|---|
| PubChem CID | 173459589 |
| Molecular Formula | C3H14O14S3 |
| Molecular Weight | 370.33 g/mol |
| Exact Mass | 369.95 |
| IUPAC Name | propane-1,2-diol;sulfuric acid |
| SMILES | CC(O)CO.O=S(=O)(O)O.O=S(=O)(O)O.O=S(=O)(O)O |
| InChI | InChI=1S/C3H8O2.3H2O4S/c1-3(5)2-4;3*1-5(2,3)4/h3-5H,2H2,1H3;3*(H2,1,2,3,4) |
| InChIKey | AJOVKTGDQUFZBB-UHFFFAOYSA-N |
| XLogP | -2.60 |
| TPSA | 264.26 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.33 |
| LogP ≤ 5 | -2.60 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|