About propane-1,2-diol;silver
propane-1,2-diol;silver (PubChem CID 158521790) has the molecular formula C3H8AgO2
and a molecular weight of 183.96 g/mol. Its IUPAC name is propane-1,2-diol;silver.
Molecular Properties
| Compound Name | propane-1,2-diol;silver |
| PubChem CID | 158521790 |
| Molecular Formula | C3H8AgO2 |
| Molecular Weight | 183.96 g/mol |
| Exact Mass | 182.96 |
| IUPAC Name | propane-1,2-diol;silver |
| SMILES | CC(O)CO.[Ag] |
| InChI | InChI=1S/C3H8O2.Ag/c1-3(5)2-4;/h3-5H,2H2,1H3; |
| InChIKey | HMHOKYMBSWDQKS-UHFFFAOYSA-N |
| XLogP | -0.64 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 183.96 |
| LogP ≤ 5 | -0.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze propane-1,2-diol;silver with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propane-1,2-diol;silver?
The IUPAC name of propane-1,2-diol;silver (CID 158521790) is propane-1,2-diol;silver.
What is the SMILES notation for propane-1,2-diol;silver?
The canonical SMILES for propane-1,2-diol;silver is CC(O)CO.[Ag].
What is the InChIKey of propane-1,2-diol;silver?
The InChIKey is HMHOKYMBSWDQKS-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H8O2.Ag/c1-3(5)2-4;/h3-5H,2H2,1H3;.
What are the key properties of propane-1,2-diol;silver?
propane-1,2-diol;silver has a molecular weight of 183.96 g/mol, XLogP of -0.64, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for propane-1,2-diol;silver is sourced from PubChem (CID 158521790), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).