About methanol;propane-1,2-diol;hydrochloride
methanol;propane-1,2-diol;hydrochloride (PubChem CID 88632623) has the molecular formula C4H13ClO3
and a molecular weight of 144.60 g/mol. Its IUPAC name is methanol;propane-1,2-diol;hydrochloride.
Molecular Properties
| Compound Name | methanol;propane-1,2-diol;hydrochloride |
| PubChem CID | 88632623 |
| Molecular Formula | C4H13ClO3 |
| Molecular Weight | 144.60 g/mol |
| Exact Mass | 144.06 |
| IUPAC Name | methanol;propane-1,2-diol;hydrochloride |
| SMILES | CC(O)CO.CO.Cl |
| InChI | InChI=1S/C3H8O2.CH4O.ClH/c1-3(5)2-4;1-2;/h3-5H,2H2,1H3;2H,1H3;1H |
| InChIKey | QYCQEIZSYDNDHD-UHFFFAOYSA-N |
| XLogP | -0.61 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 144.60 |
| LogP ≤ 5 | -0.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze methanol;propane-1,2-diol;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methanol;propane-1,2-diol;hydrochloride?
The IUPAC name of methanol;propane-1,2-diol;hydrochloride (CID 88632623) is methanol;propane-1,2-diol;hydrochloride.
What is the SMILES notation for methanol;propane-1,2-diol;hydrochloride?
The canonical SMILES for methanol;propane-1,2-diol;hydrochloride is CC(O)CO.CO.Cl.
What is the InChIKey of methanol;propane-1,2-diol;hydrochloride?
The InChIKey is QYCQEIZSYDNDHD-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H8O2.CH4O.ClH/c1-3(5)2-4;1-2;/h3-5H,2H2,1H3;2H,1H3;1H.
What are the key properties of methanol;propane-1,2-diol;hydrochloride?
methanol;propane-1,2-diol;hydrochloride has a molecular weight of 144.60 g/mol, XLogP of -0.61, 1 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methanol;propane-1,2-diol;hydrochloride is sourced from PubChem (CID 88632623), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).