C5H8F4O2 — CID 174777178
propane-1,2-diol;1,1,2,2-tetrafluoroethene (PubChem CID 174777178) has the molecular formula C5H8F4O2 and a molecular weight of 176.11 g/mol. Its IUPAC name is propane-1,2-diol;1,1,2,2-tetrafluoroethene.
| Compound Name | propane-1,2-diol;1,1,2,2-tetrafluoroethene |
|---|---|
| PubChem CID | 174777178 |
| Molecular Formula | C5H8F4O2 |
| Molecular Weight | 176.11 g/mol |
| Exact Mass | 176.05 |
| IUPAC Name | propane-1,2-diol;1,1,2,2-tetrafluoroethene |
| SMILES | CC(O)CO.FC(F)=C(F)F |
| InChI | InChI=1S/C3H8O2.C2F4/c1-3(5)2-4;3-1(4)2(5)6/h3-5H,2H2,1H3; |
| InChIKey | ZIYIMGADVFLEJH-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.11 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |