About propane-1,2-diol;trihydrochloride;dihydrofluoride
propane-1,2-diol;trihydrochloride;dihydrofluoride (PubChem CID 174772875) has the molecular formula C3H13Cl3F2O2
and a molecular weight of 225.49 g/mol. Its IUPAC name is propane-1,2-diol;trihydrochloride;dihydrofluoride.
Molecular Properties
| Compound Name | propane-1,2-diol;trihydrochloride;dihydrofluoride |
| PubChem CID | 174772875 |
| Molecular Formula | C3H13Cl3F2O2 |
| Molecular Weight | 225.49 g/mol |
| Exact Mass | 223.99 |
| IUPAC Name | propane-1,2-diol;trihydrochloride;dihydrofluoride |
| SMILES | CC(O)CO.Cl.Cl.Cl.F.F |
| InChI | InChI=1S/C3H8O2.3ClH.2FH/c1-3(5)2-4;;;;;/h3-5H,2H2,1H3;5*1H |
| InChIKey | GKTVXEHFEPVCDF-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.49 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze propane-1,2-diol;trihydrochloride;dihydrofluoride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propane-1,2-diol;trihydrochloride;dihydrofluoride?
The IUPAC name of propane-1,2-diol;trihydrochloride;dihydrofluoride (CID 174772875) is propane-1,2-diol;trihydrochloride;dihydrofluoride.
What is the SMILES notation for propane-1,2-diol;trihydrochloride;dihydrofluoride?
The canonical SMILES for propane-1,2-diol;trihydrochloride;dihydrofluoride is CC(O)CO.Cl.Cl.Cl.F.F.
What is the InChIKey of propane-1,2-diol;trihydrochloride;dihydrofluoride?
The InChIKey is GKTVXEHFEPVCDF-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H8O2.3ClH.2FH/c1-3(5)2-4;;;;;/h3-5H,2H2,1H3;5*1H.
What are the key properties of propane-1,2-diol;trihydrochloride;dihydrofluoride?
propane-1,2-diol;trihydrochloride;dihydrofluoride has a molecular weight of 225.49 g/mol, XLogP of 0.93, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for propane-1,2-diol;trihydrochloride;dihydrofluoride is sourced from PubChem (CID 174772875), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).