About chloroform;propane-1,2-diol
chloroform;propane-1,2-diol (PubChem CID 159626759) has the molecular formula C4H9Cl3O2
and a molecular weight of 195.47 g/mol. Its IUPAC name is chloroform;propane-1,2-diol.
Molecular Properties
| Compound Name | chloroform;propane-1,2-diol |
| PubChem CID | 159626759 |
| Molecular Formula | C4H9Cl3O2 |
| Molecular Weight | 195.47 g/mol |
| Exact Mass | 193.97 |
| IUPAC Name | chloroform;propane-1,2-diol |
| SMILES | CC(O)CO.ClC(Cl)Cl |
| InChI | InChI=1S/C3H8O2.CHCl3/c1-3(5)2-4;2-1(3)4/h3-5H,2H2,1H3;1H |
| InChIKey | MOPCBQOJRGPTOF-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.47 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze chloroform;propane-1,2-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of chloroform;propane-1,2-diol?
The IUPAC name of chloroform;propane-1,2-diol (CID 159626759) is chloroform;propane-1,2-diol.
What is the SMILES notation for chloroform;propane-1,2-diol?
The canonical SMILES for chloroform;propane-1,2-diol is CC(O)CO.ClC(Cl)Cl.
What is the InChIKey of chloroform;propane-1,2-diol?
The InChIKey is MOPCBQOJRGPTOF-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H8O2.CHCl3/c1-3(5)2-4;2-1(3)4/h3-5H,2H2,1H3;1H.
What are the key properties of chloroform;propane-1,2-diol?
chloroform;propane-1,2-diol has a molecular weight of 195.47 g/mol, XLogP of 1.35, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for chloroform;propane-1,2-diol is sourced from PubChem (CID 159626759), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).