About chloroform;2-methylpropan-1-ol
chloroform;2-methylpropan-1-ol (PubChem CID 22625576) has the molecular formula C5H11Cl3O
and a molecular weight of 193.50 g/mol. Its IUPAC name is chloroform;2-methylpropan-1-ol.
Molecular Properties
| Compound Name | chloroform;2-methylpropan-1-ol |
| PubChem CID | 22625576 |
| Molecular Formula | C5H11Cl3O |
| Molecular Weight | 193.50 g/mol |
| Exact Mass | 191.99 |
| IUPAC Name | chloroform;2-methylpropan-1-ol |
| SMILES | CC(C)CO.ClC(Cl)Cl |
| InChI | InChI=1S/C4H10O.CHCl3/c1-4(2)3-5;2-1(3)4/h4-5H,3H2,1-2H3;1H |
| InChIKey | CARRFNJPNUNPFH-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 193.50 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze chloroform;2-methylpropan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of chloroform;2-methylpropan-1-ol?
The IUPAC name of chloroform;2-methylpropan-1-ol (CID 22625576) is chloroform;2-methylpropan-1-ol.
What is the SMILES notation for chloroform;2-methylpropan-1-ol?
The canonical SMILES for chloroform;2-methylpropan-1-ol is CC(C)CO.ClC(Cl)Cl.
What is the InChIKey of chloroform;2-methylpropan-1-ol?
The InChIKey is CARRFNJPNUNPFH-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H10O.CHCl3/c1-4(2)3-5;2-1(3)4/h4-5H,3H2,1-2H3;1H.
What are the key properties of chloroform;2-methylpropan-1-ol?
chloroform;2-methylpropan-1-ol has a molecular weight of 193.50 g/mol, XLogP of 2.62, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for chloroform;2-methylpropan-1-ol is sourced from PubChem (CID 22625576), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).