About 2-methylpropan-1-ol;zirconium(3+)
2-methylpropan-1-ol;zirconium(3+) (PubChem CID 150803706) has the molecular formula C4H10OZr+3
and a molecular weight of 165.35 g/mol. Its IUPAC name is 2-methylpropan-1-ol;zirconium(3+).
Molecular Properties
| Compound Name | 2-methylpropan-1-ol;zirconium(3+) |
| PubChem CID | 150803706 |
| Molecular Formula | C4H10OZr+3 |
| Molecular Weight | 165.35 g/mol |
| Exact Mass | 163.98 |
| IUPAC Name | 2-methylpropan-1-ol;zirconium(3+) |
| SMILES | CC(C)CO.[Zr+3] |
| InChI | InChI=1S/C4H10O.Zr/c1-4(2)3-5;/h4-5H,3H2,1-2H3;/q;+3 |
| InChIKey | TWCZKGJKYCOLTQ-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 165.35 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-methylpropan-1-ol;zirconium(3+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylpropan-1-ol;zirconium(3+)?
The IUPAC name of 2-methylpropan-1-ol;zirconium(3+) (CID 150803706) is 2-methylpropan-1-ol;zirconium(3+).
What is the SMILES notation for 2-methylpropan-1-ol;zirconium(3+)?
The canonical SMILES for 2-methylpropan-1-ol;zirconium(3+) is CC(C)CO.[Zr+3].
What is the InChIKey of 2-methylpropan-1-ol;zirconium(3+)?
The InChIKey is TWCZKGJKYCOLTQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H10O.Zr/c1-4(2)3-5;/h4-5H,3H2,1-2H3;/q;+3.
What are the key properties of 2-methylpropan-1-ol;zirconium(3+)?
2-methylpropan-1-ol;zirconium(3+) has a molecular weight of 165.35 g/mol, XLogP of 0.63, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylpropan-1-ol;zirconium(3+) is sourced from PubChem (CID 150803706), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).