About sodium;2-methylpropan-1-ol;chloride
sodium;2-methylpropan-1-ol;chloride (PubChem CID 172733950) has the molecular formula C4H10ClNaO
and a molecular weight of 132.57 g/mol. Its IUPAC name is sodium;2-methylpropan-1-ol;chloride.
Molecular Properties
| Compound Name | sodium;2-methylpropan-1-ol;chloride |
| PubChem CID | 172733950 |
| Molecular Formula | C4H10ClNaO |
| Molecular Weight | 132.57 g/mol |
| Exact Mass | 132.03 |
| IUPAC Name | sodium;2-methylpropan-1-ol;chloride |
| SMILES | CC(C)CO.[Cl-].[Na+] |
| InChI | InChI=1S/C4H10O.ClH.Na/c1-4(2)3-5;;/h4-5H,3H2,1-2H3;1H;/q;;+1/p-1 |
| InChIKey | IEEPSZYZXFRJFG-UHFFFAOYSA-M |
| XLogP | -5.36 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 132.57 |
| LogP ≤ 5 | -5.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze sodium;2-methylpropan-1-ol;chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;2-methylpropan-1-ol;chloride?
The IUPAC name of sodium;2-methylpropan-1-ol;chloride (CID 172733950) is sodium;2-methylpropan-1-ol;chloride.
What is the SMILES notation for sodium;2-methylpropan-1-ol;chloride?
The canonical SMILES for sodium;2-methylpropan-1-ol;chloride is CC(C)CO.[Cl-].[Na+].
What is the InChIKey of sodium;2-methylpropan-1-ol;chloride?
The InChIKey is IEEPSZYZXFRJFG-UHFFFAOYSA-M. The full InChI is InChI=1S/C4H10O.ClH.Na/c1-4(2)3-5;;/h4-5H,3H2,1-2H3;1H;/q;;+1/p-1.
What are the key properties of sodium;2-methylpropan-1-ol;chloride?
sodium;2-methylpropan-1-ol;chloride has a molecular weight of 132.57 g/mol, XLogP of -5.36, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;2-methylpropan-1-ol;chloride is sourced from PubChem (CID 172733950), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).