About 2-methylpropan-1-ol;zirconium;hydrochloride
2-methylpropan-1-ol;zirconium;hydrochloride (PubChem CID 174563411) has the molecular formula C4H11ClOZr
and a molecular weight of 201.81 g/mol. Its IUPAC name is 2-methylpropan-1-ol;zirconium;hydrochloride.
Molecular Properties
| Compound Name | 2-methylpropan-1-ol;zirconium;hydrochloride |
| PubChem CID | 174563411 |
| Molecular Formula | C4H11ClOZr |
| Molecular Weight | 201.81 g/mol |
| Exact Mass | 199.95 |
| IUPAC Name | 2-methylpropan-1-ol;zirconium;hydrochloride |
| SMILES | CC(C)CO.Cl.[Zr] |
| InChI | InChI=1S/C4H10O.ClH.Zr/c1-4(2)3-5;;/h4-5H,3H2,1-2H3;1H; |
| InChIKey | INHZVTWSKRDOPG-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 201.81 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-methylpropan-1-ol;zirconium;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylpropan-1-ol;zirconium;hydrochloride?
The IUPAC name of 2-methylpropan-1-ol;zirconium;hydrochloride (CID 174563411) is 2-methylpropan-1-ol;zirconium;hydrochloride.
What is the SMILES notation for 2-methylpropan-1-ol;zirconium;hydrochloride?
The canonical SMILES for 2-methylpropan-1-ol;zirconium;hydrochloride is CC(C)CO.Cl.[Zr].
What is the InChIKey of 2-methylpropan-1-ol;zirconium;hydrochloride?
The InChIKey is INHZVTWSKRDOPG-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H10O.ClH.Zr/c1-4(2)3-5;;/h4-5H,3H2,1-2H3;1H;.
What are the key properties of 2-methylpropan-1-ol;zirconium;hydrochloride?
2-methylpropan-1-ol;zirconium;hydrochloride has a molecular weight of 201.81 g/mol, XLogP of 1.05, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylpropan-1-ol;zirconium;hydrochloride is sourced from PubChem (CID 174563411), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).