About 2-methylpropan-1-ol;zinc
2-methylpropan-1-ol;zinc (PubChem CID 151745482) has the molecular formula C4H10OZn
and a molecular weight of 139.51 g/mol. Its IUPAC name is 2-methylpropan-1-ol;zinc.
Molecular Properties
| Compound Name | 2-methylpropan-1-ol;zinc |
| PubChem CID | 151745482 |
| Molecular Formula | C4H10OZn |
| Molecular Weight | 139.51 g/mol |
| Exact Mass | 138.00 |
| IUPAC Name | 2-methylpropan-1-ol;zinc |
| SMILES | CC(C)CO.[Zn] |
| InChI | InChI=1S/C4H10O.Zn/c1-4(2)3-5;/h4-5H,3H2,1-2H3; |
| InChIKey | XOWUZWKERHSEMU-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 139.51 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 2-methylpropan-1-ol;zinc with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylpropan-1-ol;zinc?
The IUPAC name of 2-methylpropan-1-ol;zinc (CID 151745482) is 2-methylpropan-1-ol;zinc.
What is the SMILES notation for 2-methylpropan-1-ol;zinc?
The canonical SMILES for 2-methylpropan-1-ol;zinc is CC(C)CO.[Zn].
What is the InChIKey of 2-methylpropan-1-ol;zinc?
The InChIKey is XOWUZWKERHSEMU-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H10O.Zn/c1-4(2)3-5;/h4-5H,3H2,1-2H3;.
What are the key properties of 2-methylpropan-1-ol;zinc?
2-methylpropan-1-ol;zinc has a molecular weight of 139.51 g/mol, XLogP of 0.63, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylpropan-1-ol;zinc is sourced from PubChem (CID 151745482), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).