C6H18O4 — CID 157128213
ethane-1,2-diol;methane;propane-1,2-diol (PubChem CID 157128213) has the molecular formula C6H18O4 and a molecular weight of 154.21 g/mol. Its IUPAC name is ethane-1,2-diol;methane;propane-1,2-diol.
| Compound Name | ethane-1,2-diol;methane;propane-1,2-diol |
|---|---|
| PubChem CID | 157128213 |
| Molecular Formula | C6H18O4 |
| Molecular Weight | 154.21 g/mol |
| Exact Mass | 154.12 |
| IUPAC Name | ethane-1,2-diol;methane;propane-1,2-diol |
| SMILES | C.CC(O)CO.OCCO |
| InChI | InChI=1S/C3H8O2.C2H6O2.CH4/c1-3(5)2-4;3-1-2-4;/h3-5H,2H2,1H3;3-4H,1-2H2;1H4 |
| InChIKey | KHIOYYDPROMQJD-UHFFFAOYSA-N |
| XLogP | -1.03 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 154.21 |
| LogP ≤ 5 | -1.03 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |