About methoxymethane;propane-1,2-diol
methoxymethane;propane-1,2-diol (PubChem CID 23435252) has the molecular formula C5H14O3
and a molecular weight of 122.16 g/mol. Its IUPAC name is methoxymethane;propane-1,2-diol.
Molecular Properties
| Compound Name | methoxymethane;propane-1,2-diol |
| PubChem CID | 23435252 |
| Molecular Formula | C5H14O3 |
| Molecular Weight | 122.16 g/mol |
| Exact Mass | 122.09 |
| IUPAC Name | methoxymethane;propane-1,2-diol |
| SMILES | CC(O)CO.COC |
| InChI | InChI=1S/C3H8O2.C2H6O/c1-3(5)2-4;1-3-2/h3-5H,2H2,1H3;1-2H3 |
| InChIKey | JQKFLNWRTBPECK-UHFFFAOYSA-N |
| XLogP | -0.38 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 122.16 |
| LogP ≤ 5 | -0.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze methoxymethane;propane-1,2-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methoxymethane;propane-1,2-diol?
The IUPAC name of methoxymethane;propane-1,2-diol (CID 23435252) is methoxymethane;propane-1,2-diol.
What is the SMILES notation for methoxymethane;propane-1,2-diol?
The canonical SMILES for methoxymethane;propane-1,2-diol is CC(O)CO.COC.
What is the InChIKey of methoxymethane;propane-1,2-diol?
The InChIKey is JQKFLNWRTBPECK-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H8O2.C2H6O/c1-3(5)2-4;1-3-2/h3-5H,2H2,1H3;1-2H3.
What are the key properties of methoxymethane;propane-1,2-diol?
methoxymethane;propane-1,2-diol has a molecular weight of 122.16 g/mol, XLogP of -0.38, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methoxymethane;propane-1,2-diol is sourced from PubChem (CID 23435252), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).