About hydroxymethoxymethanol;propane-1,2-diol
hydroxymethoxymethanol;propane-1,2-diol (PubChem CID 87307826) has the molecular formula C5H14O5
and a molecular weight of 154.16 g/mol. Its IUPAC name is hydroxymethoxymethanol;propane-1,2-diol.
Molecular Properties
| Compound Name | hydroxymethoxymethanol;propane-1,2-diol |
| PubChem CID | 87307826 |
| Molecular Formula | C5H14O5 |
| Molecular Weight | 154.16 g/mol |
| Exact Mass | 154.08 |
| IUPAC Name | hydroxymethoxymethanol;propane-1,2-diol |
| SMILES | CC(O)CO.OCOCO |
| InChI | InChI=1S/C3H8O2.C2H6O3/c1-3(5)2-4;3-1-5-2-4/h3-5H,2H2,1H3;3-4H,1-2H2 |
| InChIKey | NRDFELFZROSHNJ-UHFFFAOYSA-N |
| XLogP | -1.74 |
| TPSA | 90.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 154.16 |
| LogP ≤ 5 | -1.74 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze hydroxymethoxymethanol;propane-1,2-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hydroxymethoxymethanol;propane-1,2-diol?
The IUPAC name of hydroxymethoxymethanol;propane-1,2-diol (CID 87307826) is hydroxymethoxymethanol;propane-1,2-diol.
What is the SMILES notation for hydroxymethoxymethanol;propane-1,2-diol?
The canonical SMILES for hydroxymethoxymethanol;propane-1,2-diol is CC(O)CO.OCOCO.
What is the InChIKey of hydroxymethoxymethanol;propane-1,2-diol?
The InChIKey is NRDFELFZROSHNJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H8O2.C2H6O3/c1-3(5)2-4;3-1-5-2-4/h3-5H,2H2,1H3;3-4H,1-2H2.
What are the key properties of hydroxymethoxymethanol;propane-1,2-diol?
hydroxymethoxymethanol;propane-1,2-diol has a molecular weight of 154.16 g/mol, XLogP of -1.74, 3 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for hydroxymethoxymethanol;propane-1,2-diol is sourced from PubChem (CID 87307826), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).