About nitroxyl;propane-1,2-diol
nitroxyl;propane-1,2-diol (PubChem CID 175455323) has the molecular formula C3H9NO3
and a molecular weight of 107.11 g/mol. Its IUPAC name is nitroxyl;propane-1,2-diol.
Molecular Properties
| Compound Name | nitroxyl;propane-1,2-diol |
| PubChem CID | 175455323 |
| Molecular Formula | C3H9NO3 |
| Molecular Weight | 107.11 g/mol |
| Exact Mass | 107.06 |
| IUPAC Name | nitroxyl;propane-1,2-diol |
| SMILES | CC(O)CO.N=O |
| InChI | InChI=1S/C3H8O2.HNO/c1-3(5)2-4;1-2/h3-5H,2H2,1H3;1H |
| InChIKey | BUGPQHDUEKJJTM-UHFFFAOYSA-N |
| XLogP | -0.31 |
| TPSA | 81.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 107.11 |
| LogP ≤ 5 | -0.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze nitroxyl;propane-1,2-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of nitroxyl;propane-1,2-diol?
The IUPAC name of nitroxyl;propane-1,2-diol (CID 175455323) is nitroxyl;propane-1,2-diol.
What is the SMILES notation for nitroxyl;propane-1,2-diol?
The canonical SMILES for nitroxyl;propane-1,2-diol is CC(O)CO.N=O.
What is the InChIKey of nitroxyl;propane-1,2-diol?
The InChIKey is BUGPQHDUEKJJTM-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H8O2.HNO/c1-3(5)2-4;1-2/h3-5H,2H2,1H3;1H.
What are the key properties of nitroxyl;propane-1,2-diol?
nitroxyl;propane-1,2-diol has a molecular weight of 107.11 g/mol, XLogP of -0.31, 1 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for nitroxyl;propane-1,2-diol is sourced from PubChem (CID 175455323), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).