About oxaldehyde;propane-1,2-diol
oxaldehyde;propane-1,2-diol (PubChem CID 87878594) has the molecular formula C5H10O4
and a molecular weight of 134.13 g/mol. Its IUPAC name is oxaldehyde;propane-1,2-diol.
Molecular Properties
| Compound Name | oxaldehyde;propane-1,2-diol |
| PubChem CID | 87878594 |
| Molecular Formula | C5H10O4 |
| Molecular Weight | 134.13 g/mol |
| Exact Mass | 134.06 |
| IUPAC Name | oxaldehyde;propane-1,2-diol |
| SMILES | CC(O)CO.O=CC=O |
| InChI | InChI=1S/C3H8O2.C2H2O2/c1-3(5)2-4;3-1-2-4/h3-5H,2H2,1H3;1-2H |
| InChIKey | QMLQBHUEXMEIRW-UHFFFAOYSA-N |
| XLogP | -1.26 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 134.13 |
| LogP ≤ 5 | -1.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze oxaldehyde;propane-1,2-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of oxaldehyde;propane-1,2-diol?
The IUPAC name of oxaldehyde;propane-1,2-diol (CID 87878594) is oxaldehyde;propane-1,2-diol.
What is the SMILES notation for oxaldehyde;propane-1,2-diol?
The canonical SMILES for oxaldehyde;propane-1,2-diol is CC(O)CO.O=CC=O.
What is the InChIKey of oxaldehyde;propane-1,2-diol?
The InChIKey is QMLQBHUEXMEIRW-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H8O2.C2H2O2/c1-3(5)2-4;3-1-2-4/h3-5H,2H2,1H3;1-2H.
What are the key properties of oxaldehyde;propane-1,2-diol?
oxaldehyde;propane-1,2-diol has a molecular weight of 134.13 g/mol, XLogP of -1.26, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for oxaldehyde;propane-1,2-diol is sourced from PubChem (CID 87878594), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).