C9H20O2 — CID 87325568
propane-1,2-diol;bis(prop-1-ene) (PubChem CID 87325568) has the molecular formula C9H20O2 and a molecular weight of 160.26 g/mol. Its IUPAC name is propane-1,2-diol;bis(prop-1-ene).
| Compound Name | propane-1,2-diol;bis(prop-1-ene) |
|---|---|
| PubChem CID | 87325568 |
| Molecular Formula | C9H20O2 |
| Molecular Weight | 160.26 g/mol |
| Exact Mass | 160.15 |
| IUPAC Name | propane-1,2-diol;bis(prop-1-ene) |
| SMILES | C=CC.C=CC.CC(O)CO |
| InChI | InChI=1S/C3H8O2.2C3H6/c1-3(5)2-4;2*1-3-2/h3-5H,2H2,1H3;2*3H,1H2,2H3 |
| InChIKey | AGFPRHALNHTGLS-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 160.26 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|