C15H32O4 — CID 88779940
2-[2-(2-hydroxypropoxy)propoxy]propan-1-ol;bis(prop-1-ene) (PubChem CID 88779940) has the molecular formula C15H32O4 and a molecular weight of 276.42 g/mol. Its IUPAC name is 2-[2-(2-hydroxypropoxy)propoxy]propan-1-ol;bis(prop-1-ene).
| Compound Name | 2-[2-(2-hydroxypropoxy)propoxy]propan-1-ol;bis(prop-1-ene) |
|---|---|
| PubChem CID | 88779940 |
| Molecular Formula | C15H32O4 |
| Molecular Weight | 276.42 g/mol |
| Exact Mass | 276.23 |
| IUPAC Name | 2-[2-(2-hydroxypropoxy)propoxy]propan-1-ol;bis(prop-1-ene) |
| SMILES | C=CC.C=CC.CC(O)COC(C)COC(C)CO |
| InChI | InChI=1S/C9H20O4.2C3H6/c1-7(11)5-12-9(3)6-13-8(2)4-10;2*1-3-2/h7-11H,4-6H2,1-3H3;2*3H,1H2,2H3 |
| InChIKey | ASNDUVZOIJNAGE-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.42 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|