C9H23BO7 — CID 175051763
boric acid;2-[2-(2-hydroxypropoxy)propoxy]propan-1-ol (PubChem CID 175051763) has the molecular formula C9H23BO7 and a molecular weight of 254.09 g/mol. Its IUPAC name is boric acid;2-[2-(2-hydroxypropoxy)propoxy]propan-1-ol.
| Compound Name | boric acid;2-[2-(2-hydroxypropoxy)propoxy]propan-1-ol |
|---|---|
| PubChem CID | 175051763 |
| Molecular Formula | C9H23BO7 |
| Molecular Weight | 254.09 g/mol |
| Exact Mass | 254.15 |
| IUPAC Name | boric acid;2-[2-(2-hydroxypropoxy)propoxy]propan-1-ol |
| SMILES | CC(O)COC(C)COC(C)CO.OB(O)O |
| InChI | InChI=1S/C9H20O4.BH3O3/c1-7(11)5-12-9(3)6-13-8(2)4-10;2-1(3)4/h7-11H,4-6H2,1-3H3;2-4H |
| InChIKey | XMNHBKFFDKHGMD-UHFFFAOYSA-N |
| XLogP | -1.88 |
| TPSA | 119.61 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.09 |
| LogP ≤ 5 | -1.88 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|