C17H38O6 — CID 173215774
ethane-1,2-diol;2-[2-(2-hydroxypropoxy)propoxy]propan-1-ol;bis(prop-1-ene) (PubChem CID 173215774) has the molecular formula C17H38O6 and a molecular weight of 338.49 g/mol. Its IUPAC name is ethane-1,2-diol;2-[2-(2-hydroxypropoxy)propoxy]propan-1-ol;bis(prop-1-ene).
| Compound Name | ethane-1,2-diol;2-[2-(2-hydroxypropoxy)propoxy]propan-1-ol;bis(prop-1-ene) |
|---|---|
| PubChem CID | 173215774 |
| Molecular Formula | C17H38O6 |
| Molecular Weight | 338.49 g/mol |
| Exact Mass | 338.27 |
| IUPAC Name | ethane-1,2-diol;2-[2-(2-hydroxypropoxy)propoxy]propan-1-ol;bis(prop-1-ene) |
| SMILES | C=CC.C=CC.CC(O)COC(C)COC(C)CO.OCCO |
| InChI | InChI=1S/C9H20O4.2C3H6.C2H6O2/c1-7(11)5-12-9(3)6-13-8(2)4-10;2*1-3-2;3-1-2-4/h7-11H,4-6H2,1-3H3;2*3H,1H2,2H3;3-4H,1-2H2 |
| InChIKey | ADHIHWUHVDGXKG-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 99.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.49 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|