C11H24O3 — CID 174902396
2-(2-hydroxypropoxy)propan-1-ol;2-methylbut-2-ene (PubChem CID 174902396) has the molecular formula C11H24O3 and a molecular weight of 204.31 g/mol. Its IUPAC name is 2-(2-hydroxypropoxy)propan-1-ol;2-methylbut-2-ene.
| Compound Name | 2-(2-hydroxypropoxy)propan-1-ol;2-methylbut-2-ene |
|---|---|
| PubChem CID | 174902396 |
| Molecular Formula | C11H24O3 |
| Molecular Weight | 204.31 g/mol |
| Exact Mass | 204.17 |
| IUPAC Name | 2-(2-hydroxypropoxy)propan-1-ol;2-methylbut-2-ene |
| SMILES | CC(O)COC(C)CO.CC=C(C)C |
| InChI | InChI=1S/C6H14O3.C5H10/c1-5(8)4-9-6(2)3-7;1-4-5(2)3/h5-8H,3-4H2,1-2H3;4H,1-3H3 |
| InChIKey | PWKKHDGJUTUBPX-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.31 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|