C7H16O5 — CID 88614617
formic acid;2-(2-hydroxypropoxy)propan-1-ol (PubChem CID 88614617) has the molecular formula C7H16O5 and a molecular weight of 180.20 g/mol. Its IUPAC name is formic acid;2-(2-hydroxypropoxy)propan-1-ol.
| Compound Name | formic acid;2-(2-hydroxypropoxy)propan-1-ol |
|---|---|
| PubChem CID | 88614617 |
| Molecular Formula | C7H16O5 |
| Molecular Weight | 180.20 g/mol |
| Exact Mass | 180.10 |
| IUPAC Name | formic acid;2-(2-hydroxypropoxy)propan-1-ol |
| SMILES | CC(O)COC(C)CO.O=CO |
| InChI | InChI=1S/C6H14O3.CH2O2/c1-5(8)4-9-6(2)3-7;2-1-3/h5-8H,3-4H2,1-2H3;1H,(H,2,3) |
| InChIKey | MGHBBPNXYJEDIB-UHFFFAOYSA-N |
| XLogP | -0.53 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.20 |
| LogP ≤ 5 | -0.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|